C29H35N5O3S — CID 25031365
4-[3-[4-(2-aminoethyl)piperidin-1-yl]-3-oxo-2-[(3-phenylphenyl)sulfonylamino]propyl]benzenecarboximidamide (PubChem CID 25031365) has the molecular formula C29H35N5O3S and a molecular weight of 533.70 g/mol. Its IUPAC name is 4-[3-[4-(2-aminoethyl)piperidin-1-yl]-3-oxo-2-[(3-phenylphenyl)sulfonylamino]propyl]benzenecarboximidamide.
| Compound Name | 4-[3-[4-(2-aminoethyl)piperidin-1-yl]-3-oxo-2-[(3-phenylphenyl)sulfonylamino]propyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 25031365 |
| Molecular Formula | C29H35N5O3S |
| Molecular Weight | 533.70 g/mol |
| Exact Mass | 533.25 |
| IUPAC Name | 4-[3-[4-(2-aminoethyl)piperidin-1-yl]-3-oxo-2-[(3-phenylphenyl)sulfonylamino]propyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(CC(NS(=O)(=O)c2cccc(-c3ccccc3)c2)C(=O)N2CCC(CCN)CC2)cc1 |
| InChI | InChI=1S/C29H35N5O3S/c30-16-13-21-14-17-34(18-15-21)29(35)27(19-22-9-11-24(12-10-22)28(31)32)33-38(36,37)26-8-4-7-25(20-26)23-5-2-1-3-6-23/h1-12,20-21,27,33H,13-19,30H2,(H3,31,32) |
| InChIKey | YZFDLRHYTDGKJN-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 142.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.70 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|