C31H44N6O5S2 — CID 72837060
4-[1-[(2S)-3-(3-carbamimidoylphenyl)-2-[[3-(2-oxopiperidin-1-yl)phenyl]sulfonylamino]propanoyl]piperidin-4-yl]-N-methylbutanamide;sulfane (PubChem CID 72837060) has the molecular formula C31H44N6O5S2 and a molecular weight of 644.86 g/mol. Its IUPAC name is 4-[1-[(2S)-3-(3-carbamimidoylphenyl)-2-[[3-(2-oxopiperidin-1-yl)phenyl]sulfonylamino]propanoyl]piperidin-4-yl]-N-methylbutanamide;sulfane.
| Compound Name | 4-[1-[(2S)-3-(3-carbamimidoylphenyl)-2-[[3-(2-oxopiperidin-1-yl)phenyl]sulfonylamino]propanoyl]piperidin-4-yl]-N-methylbutanamide;sulfane |
|---|---|
| PubChem CID | 72837060 |
| Molecular Formula | C31H44N6O5S2 |
| Molecular Weight | 644.86 g/mol |
| Exact Mass | 644.28 |
| IUPAC Name | 4-[1-[(2S)-3-(3-carbamimidoylphenyl)-2-[[3-(2-oxopiperidin-1-yl)phenyl]sulfonylamino]propanoyl]piperidin-4-yl]-N-methylbutanamide;sulfane |
| SMILES | S.[H]/N=C(\N)c1cccc(C[C@H](NS(=O)(=O)c2cccc(N3CCCCC3=O)c2)C(=O)N2CCC(CCCC(=O)NC)CC2)c1 |
| InChI | InChI=1S/C31H42N6O5S.H2S/c1-34-28(38)12-5-7-22-14-17-36(18-15-22)31(40)27(20-23-8-4-9-24(19-23)30(32)33)35-43(41,42)26-11-6-10-25(21-26)37-16-3-2-13-29(37)39;/h4,6,8-11,19,21-22,27,35H,2-3,5,7,12-18,20H2,1H3,(H3,32,33)(H,34,38);1H2/t27-;/m0./s1 |
| InChIKey | KXQYSLGHWMUIKB-YCBFMBTMSA-N |
| XLogP | 2.64 |
| TPSA | 165.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.86 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|