C30H41N7O5S — CID 25031452
4-[1-[(2S)-3-(3-carbamimidoylphenyl)-2-[[3-(2-oxopiperazin-1-yl)phenyl]sulfonylamino]propanoyl]piperidin-4-yl]-N-methylbutanamide (PubChem CID 25031452) has the molecular formula C30H41N7O5S and a molecular weight of 611.77 g/mol. Its IUPAC name is 4-[1-[(2S)-3-(3-carbamimidoylphenyl)-2-[[3-(2-oxopiperazin-1-yl)phenyl]sulfonylamino]propanoyl]piperidin-4-yl]-N-methylbutanamide.
| Compound Name | 4-[1-[(2S)-3-(3-carbamimidoylphenyl)-2-[[3-(2-oxopiperazin-1-yl)phenyl]sulfonylamino]propanoyl]piperidin-4-yl]-N-methylbutanamide |
|---|---|
| PubChem CID | 25031452 |
| Molecular Formula | C30H41N7O5S |
| Molecular Weight | 611.77 g/mol |
| Exact Mass | 611.29 |
| IUPAC Name | 4-[1-[(2S)-3-(3-carbamimidoylphenyl)-2-[[3-(2-oxopiperazin-1-yl)phenyl]sulfonylamino]propanoyl]piperidin-4-yl]-N-methylbutanamide |
| SMILES | [H]/N=C(\N)c1cccc(C[C@H](NS(=O)(=O)c2cccc(N3CCNCC3=O)c2)C(=O)N2CCC(CCCC(=O)NC)CC2)c1 |
| InChI | InChI=1S/C30H41N7O5S/c1-33-27(38)10-3-5-21-11-14-36(15-12-21)30(40)26(18-22-6-2-7-23(17-22)29(31)32)35-43(41,42)25-9-4-8-24(19-25)37-16-13-34-20-28(37)39/h2,4,6-9,17,19,21,26,34-35H,3,5,10-16,18,20H2,1H3,(H3,31,32)(H,33,38)/t26-/m0/s1 |
| InChIKey | IHORCWMVOVZDHZ-SANMLTNESA-N |
| XLogP | 0.95 |
| TPSA | 177.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.77 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|