C31H43N7O2S — CID 130388808
4-[1-[(2S)-2-[[3-(6-amino-2,3,4,5-tetrahydropyridin-3-yl)phenyl]sulfanylamino]-3-(3-carbamimidoylphenyl)propanoyl]piperidin-4-yl]-N-methylbutanamide (PubChem CID 130388808) has the molecular formula C31H43N7O2S and a molecular weight of 577.80 g/mol. Its IUPAC name is 4-[1-[(2S)-2-[[3-(6-amino-2,3,4,5-tetrahydropyridin-3-yl)phenyl]sulfanylamino]-3-(3-carbamimidoylphenyl)propanoyl]piperidin-4-yl]-N-methylbutanamide.
| Compound Name | 4-[1-[(2S)-2-[[3-(6-amino-2,3,4,5-tetrahydropyridin-3-yl)phenyl]sulfanylamino]-3-(3-carbamimidoylphenyl)propanoyl]piperidin-4-yl]-N-methylbutanamide |
|---|---|
| PubChem CID | 130388808 |
| Molecular Formula | C31H43N7O2S |
| Molecular Weight | 577.80 g/mol |
| Exact Mass | 577.32 |
| IUPAC Name | 4-[1-[(2S)-2-[[3-(6-amino-2,3,4,5-tetrahydropyridin-3-yl)phenyl]sulfanylamino]-3-(3-carbamimidoylphenyl)propanoyl]piperidin-4-yl]-N-methylbutanamide |
| SMILES | [H]/N=C(\N)c1cccc(C[C@H](NSc2cccc(C3CCC(N)=NC3)c2)C(=O)N2CCC(CCCC(=O)NC)CC2)c1 |
| InChI | InChI=1S/C31H43N7O2S/c1-35-29(39)10-3-5-21-13-15-38(16-14-21)31(40)27(18-22-6-2-8-24(17-22)30(33)34)37-41-26-9-4-7-23(19-26)25-11-12-28(32)36-20-25/h2,4,6-9,17,19,21,25,27,37H,3,5,10-16,18,20H2,1H3,(H2,32,36)(H3,33,34)(H,35,39)/t25?,27-/m0/s1 |
| InChIKey | YCBXSFVEHUFLPM-GPNIZQGCSA-N |
| XLogP | 3.57 |
| TPSA | 149.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.80 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|