C37H49N5O3S — CID 130388789
4-[1-[(2S)-2-[[3-(4-tert-butylphenyl)phenyl]sulfanylamino]-3-[3-[(E)-N'-methoxycarbamimidoyl]phenyl]propanoyl]piperidin-4-yl]-N-methylbutanamide (PubChem CID 130388789) has the molecular formula C37H49N5O3S and a molecular weight of 643.90 g/mol. Its IUPAC name is 4-[1-[(2S)-2-[[3-(4-tert-butylphenyl)phenyl]sulfanylamino]-3-[3-[(E)-N'-methoxycarbamimidoyl]phenyl]propanoyl]piperidin-4-yl]-N-methylbutanamide.
| Compound Name | 4-[1-[(2S)-2-[[3-(4-tert-butylphenyl)phenyl]sulfanylamino]-3-[3-[(E)-N'-methoxycarbamimidoyl]phenyl]propanoyl]piperidin-4-yl]-N-methylbutanamide |
|---|---|
| PubChem CID | 130388789 |
| Molecular Formula | C37H49N5O3S |
| Molecular Weight | 643.90 g/mol |
| Exact Mass | 643.36 |
| IUPAC Name | 4-[1-[(2S)-2-[[3-(4-tert-butylphenyl)phenyl]sulfanylamino]-3-[3-[(E)-N'-methoxycarbamimidoyl]phenyl]propanoyl]piperidin-4-yl]-N-methylbutanamide |
| SMILES | CNC(=O)CCCC1CCN(C(=O)[C@H](Cc2cccc(/C(N)=N\OC)c2)NSc2cccc(-c3ccc(C(C)(C)C)cc3)c2)CC1 |
| InChI | InChI=1S/C37H49N5O3S/c1-37(2,3)31-17-15-28(16-18-31)29-11-8-13-32(25-29)46-41-33(24-27-10-6-12-30(23-27)35(38)40-45-5)36(44)42-21-19-26(20-22-42)9-7-14-34(43)39-4/h6,8,10-13,15-18,23,25-26,33,41H,7,9,14,19-22,24H2,1-5H3,(H2,38,40)(H,39,43)/t33-/m0/s1 |
| InChIKey | GDYDWWCZRJJHPX-XIFFEERXSA-N |
| XLogP | 6.28 |
| TPSA | 109.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.90 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|