C30H41N7O4S — CID 130388662
N-[3-[[(2S)-3-[3-[(E)-N'-hydroxycarbamimidoyl]phenyl]-1-[4-[4-(methylamino)-4-oxobutyl]piperidin-1-yl]-1-oxopropan-2-yl]amino]sulfanylphenyl]azetidine-3-carboxamide (PubChem CID 130388662) has the molecular formula C30H41N7O4S and a molecular weight of 595.77 g/mol. Its IUPAC name is N-[3-[[(2S)-3-[3-[(E)-N'-hydroxycarbamimidoyl]phenyl]-1-[4-[4-(methylamino)-4-oxobutyl]piperidin-1-yl]-1-oxopropan-2-yl]amino]sulfanylphenyl]azetidine-3-carboxamide.
| Compound Name | N-[3-[[(2S)-3-[3-[(E)-N'-hydroxycarbamimidoyl]phenyl]-1-[4-[4-(methylamino)-4-oxobutyl]piperidin-1-yl]-1-oxopropan-2-yl]amino]sulfanylphenyl]azetidine-3-carboxamide |
|---|---|
| PubChem CID | 130388662 |
| Molecular Formula | C30H41N7O4S |
| Molecular Weight | 595.77 g/mol |
| Exact Mass | 595.29 |
| IUPAC Name | N-[3-[[(2S)-3-[3-[(E)-N'-hydroxycarbamimidoyl]phenyl]-1-[4-[4-(methylamino)-4-oxobutyl]piperidin-1-yl]-1-oxopropan-2-yl]amino]sulfanylphenyl]azetidine-3-carboxamide |
| SMILES | CNC(=O)CCCC1CCN(C(=O)[C@H](Cc2cccc(/C(N)=N\O)c2)NSc2cccc(NC(=O)C3CNC3)c2)CC1 |
| InChI | InChI=1S/C30H41N7O4S/c1-32-27(38)10-3-5-20-11-13-37(14-12-20)30(40)26(16-21-6-2-7-22(15-21)28(31)35-41)36-42-25-9-4-8-24(17-25)34-29(39)23-18-33-19-23/h2,4,6-9,15,17,20,23,26,33,36,41H,3,5,10-14,16,18-19H2,1H3,(H2,31,35)(H,32,38)(H,34,39)/t26-/m0/s1 |
| InChIKey | WMILPIYVOICZKP-SANMLTNESA-N |
| XLogP | 2.30 |
| TPSA | 161.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.77 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|