C29H34ClN5OS — CID 123335344
3-[3-[4-(2-aminoethyl)piperidin-1-yl]-2-[[3-(4-chlorophenyl)phenyl]sulfanylamino]-3-oxopropyl]benzenecarboximidamide (PubChem CID 123335344) has the molecular formula C29H34ClN5OS and a molecular weight of 536.15 g/mol. Its IUPAC name is 3-[3-[4-(2-aminoethyl)piperidin-1-yl]-2-[[3-(4-chlorophenyl)phenyl]sulfanylamino]-3-oxopropyl]benzenecarboximidamide.
| Compound Name | 3-[3-[4-(2-aminoethyl)piperidin-1-yl]-2-[[3-(4-chlorophenyl)phenyl]sulfanylamino]-3-oxopropyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 123335344 |
| Molecular Formula | C29H34ClN5OS |
| Molecular Weight | 536.15 g/mol |
| Exact Mass | 535.22 |
| IUPAC Name | 3-[3-[4-(2-aminoethyl)piperidin-1-yl]-2-[[3-(4-chlorophenyl)phenyl]sulfanylamino]-3-oxopropyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(CC(NSc2cccc(-c3ccc(Cl)cc3)c2)C(=O)N2CCC(CCN)CC2)c1 |
| InChI | InChI=1S/C29H34ClN5OS/c30-25-9-7-22(8-10-25)23-4-2-6-26(19-23)37-34-27(18-21-3-1-5-24(17-21)28(32)33)29(36)35-15-12-20(11-14-31)13-16-35/h1-10,17,19-20,27,34H,11-16,18,31H2,(H3,32,33) |
| InChIKey | LFHGPHXRJUGHIZ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 108.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.15 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|