C34H40Cl2N6O2S — CID 123201274
1-[1-[3-(3-carbamimidoylphenyl)-2-[[3-(2,4-dichlorophenyl)phenyl]sulfanylamino]propanoyl]piperidin-4-yl]-3-cyclohexylurea (PubChem CID 123201274) has the molecular formula C34H40Cl2N6O2S and a molecular weight of 667.71 g/mol. Its IUPAC name is 1-[1-[3-(3-carbamimidoylphenyl)-2-[[3-(2,4-dichlorophenyl)phenyl]sulfanylamino]propanoyl]piperidin-4-yl]-3-cyclohexylurea.
| Compound Name | 1-[1-[3-(3-carbamimidoylphenyl)-2-[[3-(2,4-dichlorophenyl)phenyl]sulfanylamino]propanoyl]piperidin-4-yl]-3-cyclohexylurea |
|---|---|
| PubChem CID | 123201274 |
| Molecular Formula | C34H40Cl2N6O2S |
| Molecular Weight | 667.71 g/mol |
| Exact Mass | 666.23 |
| IUPAC Name | 1-[1-[3-(3-carbamimidoylphenyl)-2-[[3-(2,4-dichlorophenyl)phenyl]sulfanylamino]propanoyl]piperidin-4-yl]-3-cyclohexylurea |
| SMILES | [H]/N=C(\N)c1cccc(CC(NSc2cccc(-c3ccc(Cl)cc3Cl)c2)C(=O)N2CCC(NC(=O)NC3CCCCC3)CC2)c1 |
| InChI | InChI=1S/C34H40Cl2N6O2S/c35-25-12-13-29(30(36)21-25)23-7-5-11-28(20-23)45-41-31(19-22-6-4-8-24(18-22)32(37)38)33(43)42-16-14-27(15-17-42)40-34(44)39-26-9-2-1-3-10-26/h4-8,11-13,18,20-21,26-27,31,41H,1-3,9-10,14-17,19H2,(H3,37,38)(H2,39,40,44) |
| InChIKey | XDOQFDJVHGJWKQ-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 123.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.71 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|