C24H27N5O3S — CID 57303460
3-[(2S)-3-oxo-3-piperidin-1-yl-2-(quinolin-8-ylsulfonylamino)propyl]benzenecarboximidamide (PubChem CID 57303460) has the molecular formula C24H27N5O3S and a molecular weight of 465.58 g/mol. Its IUPAC name is 3-[(2S)-3-oxo-3-piperidin-1-yl-2-(quinolin-8-ylsulfonylamino)propyl]benzenecarboximidamide.
| Compound Name | 3-[(2S)-3-oxo-3-piperidin-1-yl-2-(quinolin-8-ylsulfonylamino)propyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 57303460 |
| Molecular Formula | C24H27N5O3S |
| Molecular Weight | 465.58 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | 3-[(2S)-3-oxo-3-piperidin-1-yl-2-(quinolin-8-ylsulfonylamino)propyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(C[C@H](NS(=O)(=O)c2cccc3cccnc23)C(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C24H27N5O3S/c25-23(26)19-9-4-7-17(15-19)16-20(24(30)29-13-2-1-3-14-29)28-33(31,32)21-11-5-8-18-10-6-12-27-22(18)21/h4-12,15,20,28H,1-3,13-14,16H2,(H3,25,26)/t20-/m0/s1 |
| InChIKey | BORZQULABAVKAW-FQEVSTJZSA-N |
| XLogP | 2.42 |
| TPSA | 129.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.58 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|