C25H28N4O3S — CID 4713371
3-[2-(naphthalen-1-ylsulfonylamino)-3-oxo-3-piperidin-1-ylpropyl]benzenecarboximidamide (PubChem CID 4713371) has the molecular formula C25H28N4O3S and a molecular weight of 464.59 g/mol. Its IUPAC name is 3-[2-(naphthalen-1-ylsulfonylamino)-3-oxo-3-piperidin-1-ylpropyl]benzenecarboximidamide.
| Compound Name | 3-[2-(naphthalen-1-ylsulfonylamino)-3-oxo-3-piperidin-1-ylpropyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 4713371 |
| Molecular Formula | C25H28N4O3S |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | 3-[2-(naphthalen-1-ylsulfonylamino)-3-oxo-3-piperidin-1-ylpropyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(CC(NS(=O)(=O)c2cccc3ccccc23)C(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C25H28N4O3S/c26-24(27)20-11-6-8-18(16-20)17-22(25(30)29-14-4-1-5-15-29)28-33(31,32)23-13-7-10-19-9-2-3-12-21(19)23/h2-3,6-13,16,22,28H,1,4-5,14-15,17H2,(H3,26,27) |
| InChIKey | SFYGGBIILXMJDK-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 116.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|