C28H31N5O6S — CID 10257341
(2R)-3-[[3-(4-carbamimidoylphenyl)-1-oxo-1-piperidin-1-ylpropan-2-yl]amino]-2-(naphthalen-2-ylsulfonylamino)-3-oxopropanoic acid (PubChem CID 10257341) has the molecular formula C28H31N5O6S and a molecular weight of 565.65 g/mol. Its IUPAC name is (2R)-3-[[3-(4-carbamimidoylphenyl)-1-oxo-1-piperidin-1-ylpropan-2-yl]amino]-2-(naphthalen-2-ylsulfonylamino)-3-oxopropanoic acid.
| Compound Name | (2R)-3-[[3-(4-carbamimidoylphenyl)-1-oxo-1-piperidin-1-ylpropan-2-yl]amino]-2-(naphthalen-2-ylsulfonylamino)-3-oxopropanoic acid |
|---|---|
| PubChem CID | 10257341 |
| Molecular Formula | C28H31N5O6S |
| Molecular Weight | 565.65 g/mol |
| Exact Mass | 565.20 |
| IUPAC Name | (2R)-3-[[3-(4-carbamimidoylphenyl)-1-oxo-1-piperidin-1-ylpropan-2-yl]amino]-2-(naphthalen-2-ylsulfonylamino)-3-oxopropanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(CC(NC(=O)[C@@H](NS(=O)(=O)c2ccc3ccccc3c2)C(=O)O)C(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C28H31N5O6S/c29-25(30)20-10-8-18(9-11-20)16-23(27(35)33-14-4-1-5-15-33)31-26(34)24(28(36)37)32-40(38,39)22-13-12-19-6-2-3-7-21(19)17-22/h2-3,6-13,17,23-24,32H,1,4-5,14-16H2,(H3,29,30)(H,31,34)(H,36,37)/t23?,24-/m1/s1 |
| InChIKey | HSGSPZMQYBTNTB-XMMISQBUSA-N |
| XLogP | 1.60 |
| TPSA | 182.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.65 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|