C22H22N4O5S — CID 54106409
(2S)-2-[(2-amino-2-naphthalen-2-ylsulfonylacetyl)amino]-3-(4-carbamimidoylphenyl)propanoic acid (PubChem CID 54106409) has the molecular formula C22H22N4O5S and a molecular weight of 454.51 g/mol. Its IUPAC name is (2S)-2-[(2-amino-2-naphthalen-2-ylsulfonylacetyl)amino]-3-(4-carbamimidoylphenyl)propanoic acid.
| Compound Name | (2S)-2-[(2-amino-2-naphthalen-2-ylsulfonylacetyl)amino]-3-(4-carbamimidoylphenyl)propanoic acid |
|---|---|
| PubChem CID | 54106409 |
| Molecular Formula | C22H22N4O5S |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | (2S)-2-[(2-amino-2-naphthalen-2-ylsulfonylacetyl)amino]-3-(4-carbamimidoylphenyl)propanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(C[C@H](NC(=O)C(N)S(=O)(=O)c2ccc3ccccc3c2)C(=O)O)cc1 |
| InChI | InChI=1S/C22H22N4O5S/c23-19(24)15-7-5-13(6-8-15)11-18(22(28)29)26-21(27)20(25)32(30,31)17-10-9-14-3-1-2-4-16(14)12-17/h1-10,12,18,20H,11,25H2,(H3,23,24)(H,26,27)(H,28,29)/t18-,20?/m0/s1 |
| InChIKey | NEBLENDVOFFUSW-LROBGIAVSA-N |
| XLogP | 0.99 |
| TPSA | 176.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|