C28H34N6O5S — CID 58594928
(2S)-N-[(4-carbamimidoylphenyl)methyl]-2-[[(2R)-2-(ethylsulfonylamino)-3-naphthalen-2-ylpropanoyl]amino]pentanediamide (PubChem CID 58594928) has the molecular formula C28H34N6O5S and a molecular weight of 566.68 g/mol. Its IUPAC name is (2S)-N-[(4-carbamimidoylphenyl)methyl]-2-[[(2R)-2-(ethylsulfonylamino)-3-naphthalen-2-ylpropanoyl]amino]pentanediamide.
| Compound Name | (2S)-N-[(4-carbamimidoylphenyl)methyl]-2-[[(2R)-2-(ethylsulfonylamino)-3-naphthalen-2-ylpropanoyl]amino]pentanediamide |
|---|---|
| PubChem CID | 58594928 |
| Molecular Formula | C28H34N6O5S |
| Molecular Weight | 566.68 g/mol |
| Exact Mass | 566.23 |
| IUPAC Name | (2S)-N-[(4-carbamimidoylphenyl)methyl]-2-[[(2R)-2-(ethylsulfonylamino)-3-naphthalen-2-ylpropanoyl]amino]pentanediamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](Cc2ccc3ccccc3c2)NS(=O)(=O)CC)cc1 |
| InChI | InChI=1S/C28H34N6O5S/c1-2-40(38,39)34-24(16-19-9-10-20-5-3-4-6-22(20)15-19)28(37)33-23(13-14-25(29)35)27(36)32-17-18-7-11-21(12-8-18)26(30)31/h3-12,15,23-24,34H,2,13-14,16-17H2,1H3,(H2,29,35)(H3,30,31)(H,32,36)(H,33,37)/t23-,24+/m0/s1 |
| InChIKey | BASUXUAFLFWTRT-BJKOFHAPSA-N |
| XLogP | 1.04 |
| TPSA | 197.33 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.68 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|