C30H41N7O7S — CID 23598154
N-[(4-carbamimidoylphenyl)methyl]-2-[[2-(ethylsulfonylamino)-3-[5-(4-hydroxybutoxy)-1H-indol-3-yl]propanoyl]amino]pentanediamide (PubChem CID 23598154) has the molecular formula C30H41N7O7S and a molecular weight of 643.77 g/mol. Its IUPAC name is N-[(4-carbamimidoylphenyl)methyl]-2-[[2-(ethylsulfonylamino)-3-[5-(4-hydroxybutoxy)-1H-indol-3-yl]propanoyl]amino]pentanediamide.
| Compound Name | N-[(4-carbamimidoylphenyl)methyl]-2-[[2-(ethylsulfonylamino)-3-[5-(4-hydroxybutoxy)-1H-indol-3-yl]propanoyl]amino]pentanediamide |
|---|---|
| PubChem CID | 23598154 |
| Molecular Formula | C30H41N7O7S |
| Molecular Weight | 643.77 g/mol |
| Exact Mass | 643.28 |
| IUPAC Name | N-[(4-carbamimidoylphenyl)methyl]-2-[[2-(ethylsulfonylamino)-3-[5-(4-hydroxybutoxy)-1H-indol-3-yl]propanoyl]amino]pentanediamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)C(CCC(N)=O)NC(=O)C(Cc2c[nH]c3ccc(OCCCCO)cc23)NS(=O)(=O)CC)cc1 |
| InChI | InChI=1S/C30H41N7O7S/c1-2-45(42,43)37-26(15-21-18-34-24-10-9-22(16-23(21)24)44-14-4-3-13-38)30(41)36-25(11-12-27(31)39)29(40)35-17-19-5-7-20(8-6-19)28(32)33/h5-10,16,18,25-26,34,37-38H,2-4,11-15,17H2,1H3,(H2,31,39)(H3,32,33)(H,35,40)(H,36,41) |
| InChIKey | XGDDCKSPIFIJAC-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 242.58 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.77 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|