C27H35N7O6S — CID 58594981
(2S)-N-[(4-carbamimidoylphenyl)methyl]-2-[[(2R)-3-(5-hydroxy-1H-indol-3-yl)-2-(propylsulfonylamino)propanoyl]amino]pentanediamide (PubChem CID 58594981) has the molecular formula C27H35N7O6S and a molecular weight of 585.69 g/mol. Its IUPAC name is (2S)-N-[(4-carbamimidoylphenyl)methyl]-2-[[(2R)-3-(5-hydroxy-1H-indol-3-yl)-2-(propylsulfonylamino)propanoyl]amino]pentanediamide.
| Compound Name | (2S)-N-[(4-carbamimidoylphenyl)methyl]-2-[[(2R)-3-(5-hydroxy-1H-indol-3-yl)-2-(propylsulfonylamino)propanoyl]amino]pentanediamide |
|---|---|
| PubChem CID | 58594981 |
| Molecular Formula | C27H35N7O6S |
| Molecular Weight | 585.69 g/mol |
| Exact Mass | 585.24 |
| IUPAC Name | (2S)-N-[(4-carbamimidoylphenyl)methyl]-2-[[(2R)-3-(5-hydroxy-1H-indol-3-yl)-2-(propylsulfonylamino)propanoyl]amino]pentanediamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](Cc2c[nH]c3ccc(O)cc23)NS(=O)(=O)CCC)cc1 |
| InChI | InChI=1S/C27H35N7O6S/c1-2-11-41(39,40)34-23(12-18-15-31-21-8-7-19(35)13-20(18)21)27(38)33-22(9-10-24(28)36)26(37)32-14-16-3-5-17(6-4-16)25(29)30/h3-8,13,15,22-23,31,34-35H,2,9-12,14H2,1H3,(H2,28,36)(H3,29,30)(H,32,37)(H,33,38)/t22-,23+/m0/s1 |
| InChIKey | XGFWWNCJOGZAEJ-XZOQPEGZSA-N |
| XLogP | 0.46 |
| TPSA | 233.35 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.69 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|