C33H37N7O7S — CID 10305283
3-[[4-[[5-amino-1-[(4-carbamimidoylphenyl)methylamino]-1,5-dioxopentan-2-yl]amino]-1-(1H-indol-3-yl)-4-oxobutan-2-yl]sulfamoylmethyl]benzoic acid (PubChem CID 10305283) has the molecular formula C33H37N7O7S and a molecular weight of 675.77 g/mol. Its IUPAC name is 3-[[4-[[5-amino-1-[(4-carbamimidoylphenyl)methylamino]-1,5-dioxopentan-2-yl]amino]-1-(1H-indol-3-yl)-4-oxobutan-2-yl]sulfamoylmethyl]benzoic acid.
| Compound Name | 3-[[4-[[5-amino-1-[(4-carbamimidoylphenyl)methylamino]-1,5-dioxopentan-2-yl]amino]-1-(1H-indol-3-yl)-4-oxobutan-2-yl]sulfamoylmethyl]benzoic acid |
|---|---|
| PubChem CID | 10305283 |
| Molecular Formula | C33H37N7O7S |
| Molecular Weight | 675.77 g/mol |
| Exact Mass | 675.25 |
| IUPAC Name | 3-[[4-[[5-amino-1-[(4-carbamimidoylphenyl)methylamino]-1,5-dioxopentan-2-yl]amino]-1-(1H-indol-3-yl)-4-oxobutan-2-yl]sulfamoylmethyl]benzoic acid |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)C(CCC(N)=O)NC(=O)CC(Cc2c[nH]c3ccccc23)NS(=O)(=O)Cc2cccc(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C33H37N7O7S/c34-29(41)13-12-28(32(43)38-17-20-8-10-22(11-9-20)31(35)36)39-30(42)16-25(15-24-18-37-27-7-2-1-6-26(24)27)40-48(46,47)19-21-4-3-5-23(14-21)33(44)45/h1-11,14,18,25,28,37,40H,12-13,15-17,19H2,(H2,34,41)(H3,35,36)(H,38,43)(H,39,42)(H,44,45) |
| InChIKey | PZRIQAXUKFVWJA-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 250.42 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.77 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|