C30H34N6O2 — CID 156851553
(2S)-N-[(2S)-1-[(4-carbamimidoylphenyl)methylamino]-1-oxopropan-2-yl]-2-(1H-indol-3-ylmethylamino)-4-phenylbutanamide (PubChem CID 156851553) has the molecular formula C30H34N6O2 and a molecular weight of 510.64 g/mol. Its IUPAC name is (2S)-N-[(2S)-1-[(4-carbamimidoylphenyl)methylamino]-1-oxopropan-2-yl]-2-(1H-indol-3-ylmethylamino)-4-phenylbutanamide.
| Compound Name | (2S)-N-[(2S)-1-[(4-carbamimidoylphenyl)methylamino]-1-oxopropan-2-yl]-2-(1H-indol-3-ylmethylamino)-4-phenylbutanamide |
|---|---|
| PubChem CID | 156851553 |
| Molecular Formula | C30H34N6O2 |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.27 |
| IUPAC Name | (2S)-N-[(2S)-1-[(4-carbamimidoylphenyl)methylamino]-1-oxopropan-2-yl]-2-(1H-indol-3-ylmethylamino)-4-phenylbutanamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)[C@H](C)NC(=O)[C@H](CCc2ccccc2)NCc2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C30H34N6O2/c1-20(29(37)35-17-22-11-14-23(15-12-22)28(31)32)36-30(38)27(16-13-21-7-3-2-4-8-21)34-19-24-18-33-26-10-6-5-9-25(24)26/h2-12,14-15,18,20,27,33-34H,13,16-17,19H2,1H3,(H3,31,32)(H,35,37)(H,36,38)/t20-,27-/m0/s1 |
| InChIKey | KQPWVFULKPABBV-DCFHFQCYSA-N |
| XLogP | 3.36 |
| TPSA | 135.89 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|