C21H31N5O — CID 156851516
2-(2-aminoethylamino)-N-[(4-carbamimidoylphenyl)methyl]propanamide;ethylbenzene (PubChem CID 156851516) has the molecular formula C21H31N5O and a molecular weight of 369.51 g/mol. Its IUPAC name is 2-(2-aminoethylamino)-N-[(4-carbamimidoylphenyl)methyl]propanamide;ethylbenzene.
| Compound Name | 2-(2-aminoethylamino)-N-[(4-carbamimidoylphenyl)methyl]propanamide;ethylbenzene |
|---|---|
| PubChem CID | 156851516 |
| Molecular Formula | C21H31N5O |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.25 |
| IUPAC Name | 2-(2-aminoethylamino)-N-[(4-carbamimidoylphenyl)methyl]propanamide;ethylbenzene |
| SMILES | CCc1ccccc1.[H]/N=C(\N)c1ccc(CNC(=O)C(C)NCCN)cc1 |
| InChI | InChI=1S/C13H21N5O.C8H10/c1-9(17-7-6-14)13(19)18-8-10-2-4-11(5-3-10)12(15)16;1-2-8-6-4-3-5-7-8/h2-5,9,17H,6-8,14H2,1H3,(H3,15,16)(H,18,19);3-7H,2H2,1H3 |
| InChIKey | AZLWOUVUKQWHAV-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 117.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|