C29H35N5O2 — CID 153286744
(3S)-N'-[(4-carbamimidoylphenyl)methyl]-3-methyl-2-(2-phenylethyl)-2-(2-phenylethylamino)butanediamide (PubChem CID 153286744) has the molecular formula C29H35N5O2 and a molecular weight of 485.63 g/mol. Its IUPAC name is (3S)-N'-[(4-carbamimidoylphenyl)methyl]-3-methyl-2-(2-phenylethyl)-2-(2-phenylethylamino)butanediamide.
| Compound Name | (3S)-N'-[(4-carbamimidoylphenyl)methyl]-3-methyl-2-(2-phenylethyl)-2-(2-phenylethylamino)butanediamide |
|---|---|
| PubChem CID | 153286744 |
| Molecular Formula | C29H35N5O2 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.28 |
| IUPAC Name | (3S)-N'-[(4-carbamimidoylphenyl)methyl]-3-methyl-2-(2-phenylethyl)-2-(2-phenylethylamino)butanediamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)[C@@H](C)C(CCc2ccccc2)(NCCc2ccccc2)C(N)=O)cc1 |
| InChI | InChI=1S/C29H35N5O2/c1-21(27(35)33-20-24-12-14-25(15-13-24)26(30)31)29(28(32)36,18-16-22-8-4-2-5-9-22)34-19-17-23-10-6-3-7-11-23/h2-15,21,34H,16-20H2,1H3,(H3,30,31)(H2,32,36)(H,33,35)/t21-,29?/m1/s1 |
| InChIKey | ACUMPIMWIIXNBC-QYWNIODHSA-N |
| XLogP | 2.91 |
| TPSA | 134.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|