C24H26N4O3 — CID 23283482
N-benzyl-2-(4-carbamimidoylanilino)-2-(3,5-dimethoxyphenyl)acetamide (PubChem CID 23283482) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is N-benzyl-2-(4-carbamimidoylanilino)-2-(3,5-dimethoxyphenyl)acetamide.
| Compound Name | N-benzyl-2-(4-carbamimidoylanilino)-2-(3,5-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 23283482 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | N-benzyl-2-(4-carbamimidoylanilino)-2-(3,5-dimethoxyphenyl)acetamide |
| SMILES | [H]/N=C(\N)c1ccc(NC(C(=O)NCc2ccccc2)c2cc(OC)cc(OC)c2)cc1 |
| InChI | InChI=1S/C24H26N4O3/c1-30-20-12-18(13-21(14-20)31-2)22(24(29)27-15-16-6-4-3-5-7-16)28-19-10-8-17(9-11-19)23(25)26/h3-14,22,28H,15H2,1-2H3,(H3,25,26)(H,27,29) |
| InChIKey | UKPVGNCXJVFUSG-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 109.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|