C24H26ClN5O5 — CID 70282332
(2S)-N-benzyl-2-(4-carbamimidoylanilino)-2-(3,5-dimethoxy-4-nitrophenyl)acetamide;hydrochloride (PubChem CID 70282332) has the molecular formula C24H26ClN5O5 and a molecular weight of 499.96 g/mol. Its IUPAC name is (2S)-N-benzyl-2-(4-carbamimidoylanilino)-2-(3,5-dimethoxy-4-nitrophenyl)acetamide;hydrochloride.
| Compound Name | (2S)-N-benzyl-2-(4-carbamimidoylanilino)-2-(3,5-dimethoxy-4-nitrophenyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 70282332 |
| Molecular Formula | C24H26ClN5O5 |
| Molecular Weight | 499.96 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | (2S)-N-benzyl-2-(4-carbamimidoylanilino)-2-(3,5-dimethoxy-4-nitrophenyl)acetamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(N[C@H](C(=O)NCc2ccccc2)c2cc(OC)c([N+](=O)[O-])c(OC)c2)cc1 |
| InChI | InChI=1S/C24H25N5O5.ClH/c1-33-19-12-17(13-20(34-2)22(19)29(31)32)21(24(30)27-14-15-6-4-3-5-7-15)28-18-10-8-16(9-11-18)23(25)26;/h3-13,21,28H,14H2,1-2H3,(H3,25,26)(H,27,30);1H/t21-;/m0./s1 |
| InChIKey | ZMSHZDCUYMJBLX-BOXHHOBZSA-N |
| XLogP | 3.79 |
| TPSA | 152.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.96 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|