C26H28N4O6 — CID 23283591
(Z)-[amino-[4-[[2-(benzylamino)-2-oxo-1-(3,4,5-trimethoxyphenyl)ethyl]amino]phenyl]methylidene]carbamic acid (PubChem CID 23283591) has the molecular formula C26H28N4O6 and a molecular weight of 492.53 g/mol. Its IUPAC name is (Z)-[amino-[4-[[2-(benzylamino)-2-oxo-1-(3,4,5-trimethoxyphenyl)ethyl]amino]phenyl]methylidene]carbamic acid.
| Compound Name | (Z)-[amino-[4-[[2-(benzylamino)-2-oxo-1-(3,4,5-trimethoxyphenyl)ethyl]amino]phenyl]methylidene]carbamic acid |
|---|---|
| PubChem CID | 23283591 |
| Molecular Formula | C26H28N4O6 |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | (Z)-[amino-[4-[[2-(benzylamino)-2-oxo-1-(3,4,5-trimethoxyphenyl)ethyl]amino]phenyl]methylidene]carbamic acid |
| SMILES | COc1cc(C(Nc2ccc(/C(N)=N/C(=O)O)cc2)C(=O)NCc2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C26H28N4O6/c1-34-20-13-18(14-21(35-2)23(20)36-3)22(25(31)28-15-16-7-5-4-6-8-16)29-19-11-9-17(10-12-19)24(27)30-26(32)33/h4-14,22,29H,15H2,1-3H3,(H2,27,30)(H,28,31)(H,32,33) |
| InChIKey | WSQIKGMQNQVHOT-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 144.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|