C38H38N4O5 — CID 70282706
acetic acid;N-benzyl-2-(4-carbamimidoylanilino)-2-[3-methoxy-4-[(4-phenylphenyl)methoxy]phenyl]acetamide (PubChem CID 70282706) has the molecular formula C38H38N4O5 and a molecular weight of 630.75 g/mol. Its IUPAC name is acetic acid;N-benzyl-2-(4-carbamimidoylanilino)-2-[3-methoxy-4-[(4-phenylphenyl)methoxy]phenyl]acetamide.
| Compound Name | acetic acid;N-benzyl-2-(4-carbamimidoylanilino)-2-[3-methoxy-4-[(4-phenylphenyl)methoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 70282706 |
| Molecular Formula | C38H38N4O5 |
| Molecular Weight | 630.75 g/mol |
| Exact Mass | 630.28 |
| IUPAC Name | acetic acid;N-benzyl-2-(4-carbamimidoylanilino)-2-[3-methoxy-4-[(4-phenylphenyl)methoxy]phenyl]acetamide |
| SMILES | CC(=O)O.[H]/N=C(\N)c1ccc(NC(C(=O)NCc2ccccc2)c2ccc(OCc3ccc(-c4ccccc4)cc3)c(OC)c2)cc1 |
| InChI | InChI=1S/C36H34N4O3.C2H4O2/c1-42-33-22-30(18-21-32(33)43-24-26-12-14-28(15-13-26)27-10-6-3-7-11-27)34(36(41)39-23-25-8-4-2-5-9-25)40-31-19-16-29(17-20-31)35(37)38;1-2(3)4/h2-22,34,40H,23-24H2,1H3,(H3,37,38)(H,39,41);1H3,(H,3,4) |
| InChIKey | FOEPDMDGXKKJBQ-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 146.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.75 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|