C35H35N5O5 — CID 70282492
acetic acid;(2R)-N-benzyl-2-(4-carbamimidoylanilino)-2-[3-methoxy-4-(quinolin-7-ylmethoxy)phenyl]acetamide (PubChem CID 70282492) has the molecular formula C35H35N5O5 and a molecular weight of 605.70 g/mol. Its IUPAC name is acetic acid;(2R)-N-benzyl-2-(4-carbamimidoylanilino)-2-[3-methoxy-4-(quinolin-7-ylmethoxy)phenyl]acetamide.
| Compound Name | acetic acid;(2R)-N-benzyl-2-(4-carbamimidoylanilino)-2-[3-methoxy-4-(quinolin-7-ylmethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 70282492 |
| Molecular Formula | C35H35N5O5 |
| Molecular Weight | 605.70 g/mol |
| Exact Mass | 605.26 |
| IUPAC Name | acetic acid;(2R)-N-benzyl-2-(4-carbamimidoylanilino)-2-[3-methoxy-4-(quinolin-7-ylmethoxy)phenyl]acetamide |
| SMILES | CC(=O)O.[H]/N=C(\N)c1ccc(N[C@@H](C(=O)NCc2ccccc2)c2ccc(OCc3ccc4cccnc4c3)c(OC)c2)cc1 |
| InChI | InChI=1S/C33H31N5O3.C2H4O2/c1-40-30-19-26(13-16-29(30)41-21-23-9-10-24-8-5-17-36-28(24)18-23)31(33(39)37-20-22-6-3-2-4-7-22)38-27-14-11-25(12-15-27)32(34)35;1-2(3)4/h2-19,31,38H,20-21H2,1H3,(H3,34,35)(H,37,39);1H3,(H,3,4)/t31-;/m1./s1 |
| InChIKey | GOBWPWPTPMESQP-JSSVAETHSA-N |
| XLogP | 5.67 |
| TPSA | 159.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.70 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|