C35H37N5O5 — CID 70281097
acetic acid;2-(4-carbamimidoylanilino)-N-[2-(1H-indol-3-yl)ethyl]-2-(3-methoxy-4-phenylmethoxyphenyl)acetamide (PubChem CID 70281097) has the molecular formula C35H37N5O5 and a molecular weight of 607.71 g/mol. Its IUPAC name is acetic acid;2-(4-carbamimidoylanilino)-N-[2-(1H-indol-3-yl)ethyl]-2-(3-methoxy-4-phenylmethoxyphenyl)acetamide.
| Compound Name | acetic acid;2-(4-carbamimidoylanilino)-N-[2-(1H-indol-3-yl)ethyl]-2-(3-methoxy-4-phenylmethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 70281097 |
| Molecular Formula | C35H37N5O5 |
| Molecular Weight | 607.71 g/mol |
| Exact Mass | 607.28 |
| IUPAC Name | acetic acid;2-(4-carbamimidoylanilino)-N-[2-(1H-indol-3-yl)ethyl]-2-(3-methoxy-4-phenylmethoxyphenyl)acetamide |
| SMILES | CC(=O)O.[H]/N=C(\N)c1ccc(NC(C(=O)NCCc2c[nH]c3ccccc23)c2ccc(OCc3ccccc3)c(OC)c2)cc1 |
| InChI | InChI=1S/C33H33N5O3.C2H4O2/c1-40-30-19-24(13-16-29(30)41-21-22-7-3-2-4-8-22)31(38-26-14-11-23(12-15-26)32(34)35)33(39)36-18-17-25-20-37-28-10-6-5-9-27(25)28;1-2(3)4/h2-16,19-20,31,37-38H,17-18,21H2,1H3,(H3,34,35)(H,36,39);1H3,(H,3,4) |
| InChIKey | PHVXEZAUWYLXSU-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 162.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.71 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|