C32H39N5O7 — CID 54471864
(2S)-2-[[(2S)-2-(4-carbamimidoylanilino)-2-(3-methoxy-4-phenylmethoxyphenyl)acetyl]amino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (PubChem CID 54471864) has the molecular formula C32H39N5O7 and a molecular weight of 605.69 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-(4-carbamimidoylanilino)-2-(3-methoxy-4-phenylmethoxyphenyl)acetyl]amino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-(4-carbamimidoylanilino)-2-(3-methoxy-4-phenylmethoxyphenyl)acetyl]amino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
|---|---|
| PubChem CID | 54471864 |
| Molecular Formula | C32H39N5O7 |
| Molecular Weight | 605.69 g/mol |
| Exact Mass | 605.28 |
| IUPAC Name | (2S)-2-[[(2S)-2-(4-carbamimidoylanilino)-2-(3-methoxy-4-phenylmethoxyphenyl)acetyl]amino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(N[C@H](C(=O)N[C@@H](CCNC(=O)OC(C)(C)C)C(=O)O)c2ccc(OCc3ccccc3)c(OC)c2)cc1 |
| InChI | InChI=1S/C32H39N5O7/c1-32(2,3)44-31(41)35-17-16-24(30(39)40)37-29(38)27(36-23-13-10-21(11-14-23)28(33)34)22-12-15-25(26(18-22)42-4)43-19-20-8-6-5-7-9-20/h5-15,18,24,27,36H,16-17,19H2,1-4H3,(H3,33,34)(H,35,41)(H,37,38)(H,39,40)/t24-,27-/m0/s1 |
| InChIKey | XIXQMUOKYIHCTL-IGKIAQTJSA-N |
| XLogP | 4.20 |
| TPSA | 185.09 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.69 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|