C26H27N3O5 — CID 87905123
acetyl 2-(4-carbamimidoylanilino)-2-(3-ethoxy-4-phenylmethoxyphenyl)acetate (PubChem CID 87905123) has the molecular formula C26H27N3O5 and a molecular weight of 461.52 g/mol. Its IUPAC name is acetyl 2-(4-carbamimidoylanilino)-2-(3-ethoxy-4-phenylmethoxyphenyl)acetate.
| Compound Name | acetyl 2-(4-carbamimidoylanilino)-2-(3-ethoxy-4-phenylmethoxyphenyl)acetate |
|---|---|
| PubChem CID | 87905123 |
| Molecular Formula | C26H27N3O5 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | acetyl 2-(4-carbamimidoylanilino)-2-(3-ethoxy-4-phenylmethoxyphenyl)acetate |
| SMILES | [H]/N=C(\N)c1ccc(NC(C(=O)OC(C)=O)c2ccc(OCc3ccccc3)c(OCC)c2)cc1 |
| InChI | InChI=1S/C26H27N3O5/c1-3-32-23-15-20(11-14-22(23)33-16-18-7-5-4-6-8-18)24(26(31)34-17(2)30)29-21-12-9-19(10-13-21)25(27)28/h4-15,24,29H,3,16H2,1-2H3,(H3,27,28) |
| InChIKey | LLBLFCCXXJCHAU-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 123.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|