C26H32N3O5P — CID 25019448
[(4-carbamimidoylanilino)-(3-ethoxy-4-propan-2-yloxyphenyl)methyl]-phenylmethoxyphosphinic acid (PubChem CID 25019448) has the molecular formula C26H32N3O5P and a molecular weight of 497.53 g/mol. Its IUPAC name is [(4-carbamimidoylanilino)-(3-ethoxy-4-propan-2-yloxyphenyl)methyl]-phenylmethoxyphosphinic acid.
| Compound Name | [(4-carbamimidoylanilino)-(3-ethoxy-4-propan-2-yloxyphenyl)methyl]-phenylmethoxyphosphinic acid |
|---|---|
| PubChem CID | 25019448 |
| Molecular Formula | C26H32N3O5P |
| Molecular Weight | 497.53 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | [(4-carbamimidoylanilino)-(3-ethoxy-4-propan-2-yloxyphenyl)methyl]-phenylmethoxyphosphinic acid |
| SMILES | [H]/N=C(\N)c1ccc(NC(c2ccc(OC(C)C)c(OCC)c2)P(=O)(O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H32N3O5P/c1-4-32-24-16-21(12-15-23(24)34-18(2)3)26(29-22-13-10-20(11-14-22)25(27)28)35(30,31)33-17-19-8-6-5-7-9-19/h5-16,18,26,29H,4,17H2,1-3H3,(H3,27,28)(H,30,31) |
| InChIKey | SDOAYYGTPOVFEW-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 126.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.53 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|