C29H36N6O4 — CID 59495303
4-[[2-[2-[2-(dimethylamino)benzoyl]hydrazinyl]-1-(3-ethoxy-4-propan-2-yloxyphenyl)-2-oxoethyl]amino]benzenecarboximidamide (PubChem CID 59495303) has the molecular formula C29H36N6O4 and a molecular weight of 532.65 g/mol. Its IUPAC name is 4-[[2-[2-[2-(dimethylamino)benzoyl]hydrazinyl]-1-(3-ethoxy-4-propan-2-yloxyphenyl)-2-oxoethyl]amino]benzenecarboximidamide.
| Compound Name | 4-[[2-[2-[2-(dimethylamino)benzoyl]hydrazinyl]-1-(3-ethoxy-4-propan-2-yloxyphenyl)-2-oxoethyl]amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 59495303 |
| Molecular Formula | C29H36N6O4 |
| Molecular Weight | 532.65 g/mol |
| Exact Mass | 532.28 |
| IUPAC Name | 4-[[2-[2-[2-(dimethylamino)benzoyl]hydrazinyl]-1-(3-ethoxy-4-propan-2-yloxyphenyl)-2-oxoethyl]amino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(NC(C(=O)NNC(=O)c2ccccc2N(C)C)c2ccc(OC(C)C)c(OCC)c2)cc1 |
| InChI | InChI=1S/C29H36N6O4/c1-6-38-25-17-20(13-16-24(25)39-18(2)3)26(32-21-14-11-19(12-15-21)27(30)31)29(37)34-33-28(36)22-9-7-8-10-23(22)35(4)5/h7-18,26,32H,6H2,1-5H3,(H3,30,31)(H,33,36)(H,34,37) |
| InChIKey | WPWXJRKPZCTZSA-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 141.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.65 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|