C30H30ClF3N6O7 — CID 68652272
[1-[4-[1-(4-carbamimidoylanilino)-2-[2-(2-chlorobenzoyl)hydrazinyl]-2-oxoethyl]-2-ethoxyphenoxy]-2-(dimethylamino)-2-oxoethyl] 2,2,2-trifluoroacetate (PubChem CID 68652272) has the molecular formula C30H30ClF3N6O7 and a molecular weight of 679.05 g/mol. Its IUPAC name is [1-[4-[1-(4-carbamimidoylanilino)-2-[2-(2-chlorobenzoyl)hydrazinyl]-2-oxoethyl]-2-ethoxyphenoxy]-2-(dimethylamino)-2-oxoethyl] 2,2,2-trifluoroacetate.
| Compound Name | [1-[4-[1-(4-carbamimidoylanilino)-2-[2-(2-chlorobenzoyl)hydrazinyl]-2-oxoethyl]-2-ethoxyphenoxy]-2-(dimethylamino)-2-oxoethyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 68652272 |
| Molecular Formula | C30H30ClF3N6O7 |
| Molecular Weight | 679.05 g/mol |
| Exact Mass | 678.18 |
| IUPAC Name | [1-[4-[1-(4-carbamimidoylanilino)-2-[2-(2-chlorobenzoyl)hydrazinyl]-2-oxoethyl]-2-ethoxyphenoxy]-2-(dimethylamino)-2-oxoethyl] 2,2,2-trifluoroacetate |
| SMILES | [H]/N=C(\N)c1ccc(NC(C(=O)NNC(=O)c2ccccc2Cl)c2ccc(OC(OC(=O)C(F)(F)F)C(=O)N(C)C)c(OCC)c2)cc1 |
| InChI | InChI=1S/C30H30ClF3N6O7/c1-4-45-22-15-17(11-14-21(22)46-28(27(43)40(2)3)47-29(44)30(32,33)34)23(37-18-12-9-16(10-13-18)24(35)36)26(42)39-38-25(41)19-7-5-6-8-20(19)31/h5-15,23,28,37H,4H2,1-3H3,(H3,35,36)(H,38,41)(H,39,42) |
| InChIKey | VJTXCMCNXIIVDO-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 185.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.05 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|