C30H36F3N7O6 — CID 68652647
4-[[1-[4-[1-(dimethylamino)propan-2-yloxy]-3-ethoxyphenyl]-2-oxo-2-[2-(pyridine-2-carbonyl)hydrazinyl]ethyl]amino]benzenecarboximidamide;2,2,2-trifluoroacetic acid (PubChem CID 68652647) has the molecular formula C30H36F3N7O6 and a molecular weight of 647.66 g/mol. Its IUPAC name is 4-[[1-[4-[1-(dimethylamino)propan-2-yloxy]-3-ethoxyphenyl]-2-oxo-2-[2-(pyridine-2-carbonyl)hydrazinyl]ethyl]amino]benzenecarboximidamide;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[[1-[4-[1-(dimethylamino)propan-2-yloxy]-3-ethoxyphenyl]-2-oxo-2-[2-(pyridine-2-carbonyl)hydrazinyl]ethyl]amino]benzenecarboximidamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 68652647 |
| Molecular Formula | C30H36F3N7O6 |
| Molecular Weight | 647.66 g/mol |
| Exact Mass | 647.27 |
| IUPAC Name | 4-[[1-[4-[1-(dimethylamino)propan-2-yloxy]-3-ethoxyphenyl]-2-oxo-2-[2-(pyridine-2-carbonyl)hydrazinyl]ethyl]amino]benzenecarboximidamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc(NC(C(=O)NNC(=O)c2ccccn2)c2ccc(OC(C)CN(C)C)c(OCC)c2)cc1 |
| InChI | InChI=1S/C28H35N7O4.C2HF3O2/c1-5-38-24-16-20(11-14-23(24)39-18(2)17-35(3)4)25(32-21-12-9-19(10-13-21)26(29)30)28(37)34-33-27(36)22-8-6-7-15-31-22;3-2(4,5)1(6)7/h6-16,18,25,32H,5,17H2,1-4H3,(H3,29,30)(H,33,36)(H,34,37);(H,6,7) |
| InChIKey | XZXJSIVMIZDVKY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 191.99 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.66 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|