C29H33F3N6O6 — CID 68652687
1-[[2-(4-carbamimidoylanilino)-2-(3-ethoxy-4-propan-2-yloxyphenyl)acetyl]amino]-1-phenylurea;2,2,2-trifluoroacetic acid (PubChem CID 68652687) has the molecular formula C29H33F3N6O6 and a molecular weight of 618.61 g/mol. Its IUPAC name is 1-[[2-(4-carbamimidoylanilino)-2-(3-ethoxy-4-propan-2-yloxyphenyl)acetyl]amino]-1-phenylurea;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[[2-(4-carbamimidoylanilino)-2-(3-ethoxy-4-propan-2-yloxyphenyl)acetyl]amino]-1-phenylurea;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 68652687 |
| Molecular Formula | C29H33F3N6O6 |
| Molecular Weight | 618.61 g/mol |
| Exact Mass | 618.24 |
| IUPAC Name | 1-[[2-(4-carbamimidoylanilino)-2-(3-ethoxy-4-propan-2-yloxyphenyl)acetyl]amino]-1-phenylurea;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc(NC(C(=O)NN(C(N)=O)c2ccccc2)c2ccc(OC(C)C)c(OCC)c2)cc1 |
| InChI | InChI=1S/C27H32N6O4.C2HF3O2/c1-4-36-23-16-19(12-15-22(23)37-17(2)3)24(31-20-13-10-18(11-14-20)25(28)29)26(34)32-33(27(30)35)21-8-6-5-7-9-21;3-2(4,5)1(6)7/h5-17,24,31H,4H2,1-3H3,(H3,28,29)(H2,30,35)(H,32,34);(H,6,7) |
| InChIKey | SRHNHZYMVYRZBX-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 193.09 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.61 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|