C26H30FN5O3 — CID 59495376
4-[[1-(3-ethoxy-4-propan-2-yloxyphenyl)-2-[2-(3-fluorophenyl)hydrazinyl]-2-oxoethyl]amino]benzenecarboximidamide (PubChem CID 59495376) has the molecular formula C26H30FN5O3 and a molecular weight of 479.56 g/mol. Its IUPAC name is 4-[[1-(3-ethoxy-4-propan-2-yloxyphenyl)-2-[2-(3-fluorophenyl)hydrazinyl]-2-oxoethyl]amino]benzenecarboximidamide.
| Compound Name | 4-[[1-(3-ethoxy-4-propan-2-yloxyphenyl)-2-[2-(3-fluorophenyl)hydrazinyl]-2-oxoethyl]amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 59495376 |
| Molecular Formula | C26H30FN5O3 |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.23 |
| IUPAC Name | 4-[[1-(3-ethoxy-4-propan-2-yloxyphenyl)-2-[2-(3-fluorophenyl)hydrazinyl]-2-oxoethyl]amino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(NC(C(=O)NNc2cccc(F)c2)c2ccc(OC(C)C)c(OCC)c2)cc1 |
| InChI | InChI=1S/C26H30FN5O3/c1-4-34-23-14-18(10-13-22(23)35-16(2)3)24(30-20-11-8-17(9-12-20)25(28)29)26(33)32-31-21-7-5-6-19(27)15-21/h5-16,24,30-31H,4H2,1-3H3,(H3,28,29)(H,32,33) |
| InChIKey | MTZQAGPMKPQGJD-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 121.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|