C28H31F4N5O7S — CID 68653237
4-[[1-(3-ethoxy-4-propan-2-yloxyphenyl)-2-[2-(3-fluorophenyl)sulfonylhydrazinyl]-2-oxoethyl]amino]benzenecarboximidamide;2,2,2-trifluoroacetic acid (PubChem CID 68653237) has the molecular formula C28H31F4N5O7S and a molecular weight of 657.64 g/mol. Its IUPAC name is 4-[[1-(3-ethoxy-4-propan-2-yloxyphenyl)-2-[2-(3-fluorophenyl)sulfonylhydrazinyl]-2-oxoethyl]amino]benzenecarboximidamide;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[[1-(3-ethoxy-4-propan-2-yloxyphenyl)-2-[2-(3-fluorophenyl)sulfonylhydrazinyl]-2-oxoethyl]amino]benzenecarboximidamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 68653237 |
| Molecular Formula | C28H31F4N5O7S |
| Molecular Weight | 657.64 g/mol |
| Exact Mass | 657.19 |
| IUPAC Name | 4-[[1-(3-ethoxy-4-propan-2-yloxyphenyl)-2-[2-(3-fluorophenyl)sulfonylhydrazinyl]-2-oxoethyl]amino]benzenecarboximidamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc(NC(C(=O)NNS(=O)(=O)c2cccc(F)c2)c2ccc(OC(C)C)c(OCC)c2)cc1 |
| InChI | InChI=1S/C26H30FN5O5S.C2HF3O2/c1-4-36-23-14-18(10-13-22(23)37-16(2)3)24(30-20-11-8-17(9-12-20)25(28)29)26(33)31-32-38(34,35)21-7-5-6-19(27)15-21;3-2(4,5)1(6)7/h5-16,24,30,32H,4H2,1-3H3,(H3,28,29)(H,31,33);(H,6,7) |
| InChIKey | KWHDWGWVDAIBDW-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 192.93 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.64 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|