C23H30F3N5O5 — CID 68652840
4-[[1-(3-ethoxy-4-propan-2-yloxyphenyl)-2-(2-methylhydrazinyl)-2-oxoethyl]amino]benzenecarboximidamide;2,2,2-trifluoroacetic acid (PubChem CID 68652840) has the molecular formula C23H30F3N5O5 and a molecular weight of 513.52 g/mol. Its IUPAC name is 4-[[1-(3-ethoxy-4-propan-2-yloxyphenyl)-2-(2-methylhydrazinyl)-2-oxoethyl]amino]benzenecarboximidamide;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[[1-(3-ethoxy-4-propan-2-yloxyphenyl)-2-(2-methylhydrazinyl)-2-oxoethyl]amino]benzenecarboximidamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 68652840 |
| Molecular Formula | C23H30F3N5O5 |
| Molecular Weight | 513.52 g/mol |
| Exact Mass | 513.22 |
| IUPAC Name | 4-[[1-(3-ethoxy-4-propan-2-yloxyphenyl)-2-(2-methylhydrazinyl)-2-oxoethyl]amino]benzenecarboximidamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc(NC(C(=O)NNC)c2ccc(OC(C)C)c(OCC)c2)cc1 |
| InChI | InChI=1S/C21H29N5O3.C2HF3O2/c1-5-28-18-12-15(8-11-17(18)29-13(2)3)19(21(27)26-24-4)25-16-9-6-14(7-10-16)20(22)23;3-2(4,5)1(6)7/h6-13,19,24-25H,5H2,1-4H3,(H3,22,23)(H,26,27);(H,6,7) |
| InChIKey | BYEYYPSPQWKTKV-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 158.79 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.52 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|