C28H30ClF3N6O6 — CID 87530980
4-[[2-[2-(2-chloropyridine-4-carbonyl)hydrazinyl]-1-(3-ethoxy-4-propan-2-yloxyphenyl)-2-oxoethyl]amino]benzenecarboximidamide;2,2,2-trifluoroacetic acid (PubChem CID 87530980) has the molecular formula C28H30ClF3N6O6 and a molecular weight of 639.03 g/mol. Its IUPAC name is 4-[[2-[2-(2-chloropyridine-4-carbonyl)hydrazinyl]-1-(3-ethoxy-4-propan-2-yloxyphenyl)-2-oxoethyl]amino]benzenecarboximidamide;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[[2-[2-(2-chloropyridine-4-carbonyl)hydrazinyl]-1-(3-ethoxy-4-propan-2-yloxyphenyl)-2-oxoethyl]amino]benzenecarboximidamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 87530980 |
| Molecular Formula | C28H30ClF3N6O6 |
| Molecular Weight | 639.03 g/mol |
| Exact Mass | 638.19 |
| IUPAC Name | 4-[[2-[2-(2-chloropyridine-4-carbonyl)hydrazinyl]-1-(3-ethoxy-4-propan-2-yloxyphenyl)-2-oxoethyl]amino]benzenecarboximidamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc(NC(C(=O)NNC(=O)c2ccnc(Cl)c2)c2ccc(OC(C)C)c(OCC)c2)cc1 |
| InChI | InChI=1S/C26H29ClN6O4.C2HF3O2/c1-4-36-21-13-17(7-10-20(21)37-15(2)3)23(31-19-8-5-16(6-9-19)24(28)29)26(35)33-32-25(34)18-11-12-30-22(27)14-18;3-2(4,5)1(6)7/h5-15,23,31H,4H2,1-3H3,(H3,28,29)(H,32,34)(H,33,35);(H,6,7) |
| InChIKey | LCSGIKXTESQPOJ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 188.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.03 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|