C26H31ClN6O4 — CID 143213136
2-chloro-N'-[2-[4-(diaminomethyl)anilino]-2-(3-ethoxy-4-propan-2-yloxyphenyl)acetyl]pyridine-4-carbohydrazide (PubChem CID 143213136) has the molecular formula C26H31ClN6O4 and a molecular weight of 527.03 g/mol. Its IUPAC name is 2-chloro-N'-[2-[4-(diaminomethyl)anilino]-2-(3-ethoxy-4-propan-2-yloxyphenyl)acetyl]pyridine-4-carbohydrazide.
| Compound Name | 2-chloro-N'-[2-[4-(diaminomethyl)anilino]-2-(3-ethoxy-4-propan-2-yloxyphenyl)acetyl]pyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 143213136 |
| Molecular Formula | C26H31ClN6O4 |
| Molecular Weight | 527.03 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | 2-chloro-N'-[2-[4-(diaminomethyl)anilino]-2-(3-ethoxy-4-propan-2-yloxyphenyl)acetyl]pyridine-4-carbohydrazide |
| SMILES | CCOc1cc(C(Nc2ccc(C(N)N)cc2)C(=O)NNC(=O)c2ccnc(Cl)c2)ccc1OC(C)C |
| InChI | InChI=1S/C26H31ClN6O4/c1-4-36-21-13-17(7-10-20(21)37-15(2)3)23(31-19-8-5-16(6-9-19)24(28)29)26(35)33-32-25(34)18-11-12-30-22(27)14-18/h5-15,23-24,31H,4,28-29H2,1-3H3,(H,32,34)(H,33,35) |
| InChIKey | IDGVHRWSINXYCR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 153.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.03 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|