C30H37N7O5 — CID 59495534
4-[[1-(3-ethoxy-4-propan-2-yloxyphenyl)-2-[2-(6-morpholin-4-ylpyridine-3-carbonyl)hydrazinyl]-2-oxoethyl]amino]benzenecarboximidamide (PubChem CID 59495534) has the molecular formula C30H37N7O5 and a molecular weight of 575.67 g/mol. Its IUPAC name is 4-[[1-(3-ethoxy-4-propan-2-yloxyphenyl)-2-[2-(6-morpholin-4-ylpyridine-3-carbonyl)hydrazinyl]-2-oxoethyl]amino]benzenecarboximidamide.
| Compound Name | 4-[[1-(3-ethoxy-4-propan-2-yloxyphenyl)-2-[2-(6-morpholin-4-ylpyridine-3-carbonyl)hydrazinyl]-2-oxoethyl]amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 59495534 |
| Molecular Formula | C30H37N7O5 |
| Molecular Weight | 575.67 g/mol |
| Exact Mass | 575.29 |
| IUPAC Name | 4-[[1-(3-ethoxy-4-propan-2-yloxyphenyl)-2-[2-(6-morpholin-4-ylpyridine-3-carbonyl)hydrazinyl]-2-oxoethyl]amino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(NC(C(=O)NNC(=O)c2ccc(N3CCOCC3)nc2)c2ccc(OC(C)C)c(OCC)c2)cc1 |
| InChI | InChI=1S/C30H37N7O5/c1-4-41-25-17-21(7-11-24(25)42-19(2)3)27(34-23-9-5-20(6-10-23)28(31)32)30(39)36-35-29(38)22-8-12-26(33-18-22)37-13-15-40-16-14-37/h5-12,17-19,27,34H,4,13-16H2,1-3H3,(H3,31,32)(H,35,38)(H,36,39) |
| InChIKey | DQNSQRVUIKFMQK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 163.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.67 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|