C27H33BrN6O4 — CID 89346423
4-[[2-[2-[(3E,5Z)-6-amino-3-bromo-2-methylidenehexa-3,5-dienoyl]hydrazinyl]-1-(3-ethoxy-4-propan-2-yloxyphenyl)-2-oxoethyl]amino]benzenecarboximidamide (PubChem CID 89346423) has the molecular formula C27H33BrN6O4 and a molecular weight of 585.50 g/mol. Its IUPAC name is 4-[[2-[2-[(3E,5Z)-6-amino-3-bromo-2-methylidenehexa-3,5-dienoyl]hydrazinyl]-1-(3-ethoxy-4-propan-2-yloxyphenyl)-2-oxoethyl]amino]benzenecarboximidamide.
| Compound Name | 4-[[2-[2-[(3E,5Z)-6-amino-3-bromo-2-methylidenehexa-3,5-dienoyl]hydrazinyl]-1-(3-ethoxy-4-propan-2-yloxyphenyl)-2-oxoethyl]amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 89346423 |
| Molecular Formula | C27H33BrN6O4 |
| Molecular Weight | 585.50 g/mol |
| Exact Mass | 584.17 |
| IUPAC Name | 4-[[2-[2-[(3E,5Z)-6-amino-3-bromo-2-methylidenehexa-3,5-dienoyl]hydrazinyl]-1-(3-ethoxy-4-propan-2-yloxyphenyl)-2-oxoethyl]amino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(NC(C(=O)NNC(=O)C(=C)/C(Br)=C\C=C/N)c2ccc(OC(C)C)c(OCC)c2)cc1 |
| InChI | InChI=1S/C27H33BrN6O4/c1-5-37-23-15-19(10-13-22(23)38-16(2)3)24(32-20-11-8-18(9-12-20)25(30)31)27(36)34-33-26(35)17(4)21(28)7-6-14-29/h6-16,24,32H,4-5,29H2,1-3H3,(H3,30,31)(H,33,35)(H,34,36)/b14-6-,21-7+ |
| InChIKey | HDDOGNYRTRBIAG-ZKELSDERSA-N |
| XLogP | 3.76 |
| TPSA | 164.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.50 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|