C31H39N7O5 — CID 89346531
4-[[1-(3-ethoxy-4-propan-2-yloxyphenyl)-2-[2-methyl-2-(2-morpholin-4-ylpyridine-3-carbonyl)hydrazinyl]-2-oxoethyl]amino]benzenecarboximidamide (PubChem CID 89346531) has the molecular formula C31H39N7O5 and a molecular weight of 589.70 g/mol. Its IUPAC name is 4-[[1-(3-ethoxy-4-propan-2-yloxyphenyl)-2-[2-methyl-2-(2-morpholin-4-ylpyridine-3-carbonyl)hydrazinyl]-2-oxoethyl]amino]benzenecarboximidamide.
| Compound Name | 4-[[1-(3-ethoxy-4-propan-2-yloxyphenyl)-2-[2-methyl-2-(2-morpholin-4-ylpyridine-3-carbonyl)hydrazinyl]-2-oxoethyl]amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 89346531 |
| Molecular Formula | C31H39N7O5 |
| Molecular Weight | 589.70 g/mol |
| Exact Mass | 589.30 |
| IUPAC Name | 4-[[1-(3-ethoxy-4-propan-2-yloxyphenyl)-2-[2-methyl-2-(2-morpholin-4-ylpyridine-3-carbonyl)hydrazinyl]-2-oxoethyl]amino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(NC(C(=O)NN(C)C(=O)c2cccnc2N2CCOCC2)c2ccc(OC(C)C)c(OCC)c2)cc1 |
| InChI | InChI=1S/C31H39N7O5/c1-5-42-26-19-22(10-13-25(26)43-20(2)3)27(35-23-11-8-21(9-12-23)28(32)33)30(39)36-37(4)31(40)24-7-6-14-34-29(24)38-15-17-41-18-16-38/h6-14,19-20,27,35H,5,15-18H2,1-4H3,(H3,32,33)(H,36,39) |
| InChIKey | DIYAEGJMDNNZRR-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 155.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.70 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|