C27H32N6O4S — CID 59495505
4-[[1-(3-ethoxy-4-propan-2-yloxyphenyl)-2-[2-(2-methylsulfanylpyridine-3-carbonyl)hydrazinyl]-2-oxoethyl]amino]benzenecarboximidamide (PubChem CID 59495505) has the molecular formula C27H32N6O4S and a molecular weight of 536.66 g/mol. Its IUPAC name is 4-[[1-(3-ethoxy-4-propan-2-yloxyphenyl)-2-[2-(2-methylsulfanylpyridine-3-carbonyl)hydrazinyl]-2-oxoethyl]amino]benzenecarboximidamide.
| Compound Name | 4-[[1-(3-ethoxy-4-propan-2-yloxyphenyl)-2-[2-(2-methylsulfanylpyridine-3-carbonyl)hydrazinyl]-2-oxoethyl]amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 59495505 |
| Molecular Formula | C27H32N6O4S |
| Molecular Weight | 536.66 g/mol |
| Exact Mass | 536.22 |
| IUPAC Name | 4-[[1-(3-ethoxy-4-propan-2-yloxyphenyl)-2-[2-(2-methylsulfanylpyridine-3-carbonyl)hydrazinyl]-2-oxoethyl]amino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(NC(C(=O)NNC(=O)c2cccnc2SC)c2ccc(OC(C)C)c(OCC)c2)cc1 |
| InChI | InChI=1S/C27H32N6O4S/c1-5-36-22-15-18(10-13-21(22)37-16(2)3)23(31-19-11-8-17(9-12-19)24(28)29)26(35)33-32-25(34)20-7-6-14-30-27(20)38-4/h6-16,23,31H,5H2,1-4H3,(H3,28,29)(H,32,34)(H,33,35) |
| InChIKey | XUHHDRFPAXIPES-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 151.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.66 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|