C28H30F4N6O7 — CID 68653067
4-[[1-[3-ethoxy-4-(2-methoxyethoxy)phenyl]-2-[2-(2-fluoropyridine-3-carbonyl)hydrazinyl]-2-oxoethyl]amino]benzenecarboximidamide;2,2,2-trifluoroacetic acid (PubChem CID 68653067) has the molecular formula C28H30F4N6O7 and a molecular weight of 638.58 g/mol. Its IUPAC name is 4-[[1-[3-ethoxy-4-(2-methoxyethoxy)phenyl]-2-[2-(2-fluoropyridine-3-carbonyl)hydrazinyl]-2-oxoethyl]amino]benzenecarboximidamide;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[[1-[3-ethoxy-4-(2-methoxyethoxy)phenyl]-2-[2-(2-fluoropyridine-3-carbonyl)hydrazinyl]-2-oxoethyl]amino]benzenecarboximidamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 68653067 |
| Molecular Formula | C28H30F4N6O7 |
| Molecular Weight | 638.58 g/mol |
| Exact Mass | 638.21 |
| IUPAC Name | 4-[[1-[3-ethoxy-4-(2-methoxyethoxy)phenyl]-2-[2-(2-fluoropyridine-3-carbonyl)hydrazinyl]-2-oxoethyl]amino]benzenecarboximidamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc(NC(C(=O)NNC(=O)c2cccnc2F)c2ccc(OCCOC)c(OCC)c2)cc1 |
| InChI | InChI=1S/C26H29FN6O5.C2HF3O2/c1-3-37-21-15-17(8-11-20(21)38-14-13-36-2)22(31-18-9-6-16(7-10-18)24(28)29)26(35)33-32-25(34)19-5-4-12-30-23(19)27;3-2(4,5)1(6)7/h4-12,15,22,31H,3,13-14H2,1-2H3,(H3,28,29)(H,32,34)(H,33,35);(H,6,7) |
| InChIKey | HIZPETQIPHCFMM-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 197.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.58 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|