C33H38F3N5O6 — CID 143213206
4-[[1-[3,4-bis(prop-2-enoxy)phenyl]-2-[2-(2-methylbenzoyl)hydrazinyl]-2-oxoethyl]amino]benzenecarboximidamide;ethane;2,2,2-trifluoroacetic acid (PubChem CID 143213206) has the molecular formula C33H38F3N5O6 and a molecular weight of 657.69 g/mol. Its IUPAC name is 4-[[1-[3,4-bis(prop-2-enoxy)phenyl]-2-[2-(2-methylbenzoyl)hydrazinyl]-2-oxoethyl]amino]benzenecarboximidamide;ethane;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[[1-[3,4-bis(prop-2-enoxy)phenyl]-2-[2-(2-methylbenzoyl)hydrazinyl]-2-oxoethyl]amino]benzenecarboximidamide;ethane;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 143213206 |
| Molecular Formula | C33H38F3N5O6 |
| Molecular Weight | 657.69 g/mol |
| Exact Mass | 657.28 |
| IUPAC Name | 4-[[1-[3,4-bis(prop-2-enoxy)phenyl]-2-[2-(2-methylbenzoyl)hydrazinyl]-2-oxoethyl]amino]benzenecarboximidamide;ethane;2,2,2-trifluoroacetic acid |
| SMILES | CC.O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc(NC(C(=O)NNC(=O)c2ccccc2C)c2ccc(OCC=C)c(OCC=C)c2)cc1 |
| InChI | InChI=1S/C29H31N5O4.C2HF3O2.C2H6/c1-4-16-37-24-15-12-21(18-25(24)38-17-5-2)26(32-22-13-10-20(11-14-22)27(30)31)29(36)34-33-28(35)23-9-7-6-8-19(23)3;3-2(4,5)1(6)7;1-2/h4-15,18,26,32H,1-2,16-17H2,3H3,(H3,30,31)(H,33,35)(H,34,36);(H,6,7);1-2H3 |
| InChIKey | KYCCEMGTMLRRQU-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 175.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.69 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|