C21H24ClN3O4 — CID 68652501
2-[3,4-bis(prop-2-enoxy)phenyl]-2-(4-carbamimidoylanilino)acetic acid;hydrochloride (PubChem CID 68652501) has the molecular formula C21H24ClN3O4 and a molecular weight of 417.89 g/mol. Its IUPAC name is 2-[3,4-bis(prop-2-enoxy)phenyl]-2-(4-carbamimidoylanilino)acetic acid;hydrochloride.
| Compound Name | 2-[3,4-bis(prop-2-enoxy)phenyl]-2-(4-carbamimidoylanilino)acetic acid;hydrochloride |
|---|---|
| PubChem CID | 68652501 |
| Molecular Formula | C21H24ClN3O4 |
| Molecular Weight | 417.89 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 2-[3,4-bis(prop-2-enoxy)phenyl]-2-(4-carbamimidoylanilino)acetic acid;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(NC(C(=O)O)c2ccc(OCC=C)c(OCC=C)c2)cc1 |
| InChI | InChI=1S/C21H23N3O4.ClH/c1-3-11-27-17-10-7-15(13-18(17)28-12-4-2)19(21(25)26)24-16-8-5-14(6-9-16)20(22)23;/h3-10,13,19,24H,1-2,11-12H2,(H3,22,23)(H,25,26);1H |
| InChIKey | DKTYEHNYTLPVDX-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 117.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.89 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|