C20H24N4O5 — CID 22038752
2-[3-(2-amino-2-oxoethoxy)-4-propan-2-yloxyphenyl]-2-(4-carbamimidoylanilino)acetic acid (PubChem CID 22038752) has the molecular formula C20H24N4O5 and a molecular weight of 400.44 g/mol. Its IUPAC name is 2-[3-(2-amino-2-oxoethoxy)-4-propan-2-yloxyphenyl]-2-(4-carbamimidoylanilino)acetic acid.
| Compound Name | 2-[3-(2-amino-2-oxoethoxy)-4-propan-2-yloxyphenyl]-2-(4-carbamimidoylanilino)acetic acid |
|---|---|
| PubChem CID | 22038752 |
| Molecular Formula | C20H24N4O5 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 2-[3-(2-amino-2-oxoethoxy)-4-propan-2-yloxyphenyl]-2-(4-carbamimidoylanilino)acetic acid |
| SMILES | [H]/N=C(\N)c1ccc(NC(C(=O)O)c2ccc(OC(C)C)c(OCC(N)=O)c2)cc1 |
| InChI | InChI=1S/C20H24N4O5/c1-11(2)29-15-8-5-13(9-16(15)28-10-17(21)25)18(20(26)27)24-14-6-3-12(4-7-14)19(22)23/h3-9,11,18,24H,10H2,1-2H3,(H2,21,25)(H3,22,23)(H,26,27) |
| InChIKey | OUTILTXOSXJNPK-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 160.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|