C19H21N3O5 — CID 22039677
2-(4-carbamimidoylanilino)-2-[2-(carboxymethoxy)-5-ethylphenyl]acetic acid (PubChem CID 22039677) has the molecular formula C19H21N3O5 and a molecular weight of 371.39 g/mol. Its IUPAC name is 2-(4-carbamimidoylanilino)-2-[2-(carboxymethoxy)-5-ethylphenyl]acetic acid.
| Compound Name | 2-(4-carbamimidoylanilino)-2-[2-(carboxymethoxy)-5-ethylphenyl]acetic acid |
|---|---|
| PubChem CID | 22039677 |
| Molecular Formula | C19H21N3O5 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 2-(4-carbamimidoylanilino)-2-[2-(carboxymethoxy)-5-ethylphenyl]acetic acid |
| SMILES | [H]/N=C(\N)c1ccc(NC(C(=O)O)c2cc(CC)ccc2OCC(=O)O)cc1 |
| InChI | InChI=1S/C19H21N3O5/c1-2-11-3-8-15(27-10-16(23)24)14(9-11)17(19(25)26)22-13-6-4-12(5-7-13)18(20)21/h3-9,17,22H,2,10H2,1H3,(H3,20,21)(H,23,24)(H,25,26) |
| InChIKey | RYYSPKAEFFCANK-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 145.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|