C23H30ClN4O4- — CID 22039030
2-(4-carbamimidoylanilino)-2-[5-ethyl-2-(2-morpholin-4-ylethoxy)phenyl]acetate;hydrochloride (PubChem CID 22039030) has the molecular formula C23H30ClN4O4- and a molecular weight of 461.97 g/mol. Its IUPAC name is 2-(4-carbamimidoylanilino)-2-[5-ethyl-2-(2-morpholin-4-ylethoxy)phenyl]acetate;hydrochloride.
| Compound Name | 2-(4-carbamimidoylanilino)-2-[5-ethyl-2-(2-morpholin-4-ylethoxy)phenyl]acetate;hydrochloride |
|---|---|
| PubChem CID | 22039030 |
| Molecular Formula | C23H30ClN4O4- |
| Molecular Weight | 461.97 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | 2-(4-carbamimidoylanilino)-2-[5-ethyl-2-(2-morpholin-4-ylethoxy)phenyl]acetate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(NC(C(=O)[O-])c2cc(CC)ccc2OCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C23H30N4O4.ClH/c1-2-16-3-8-20(31-14-11-27-9-12-30-13-10-27)19(15-16)21(23(28)29)26-18-6-4-17(5-7-18)22(24)25;/h3-8,15,21,26H,2,9-14H2,1H3,(H3,24,25)(H,28,29);1H/p-1 |
| InChIKey | NAEHQVGZLJPAMS-UHFFFAOYSA-M |
| XLogP | 1.57 |
| TPSA | 123.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.97 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|