C23H31ClN5O2- — CID 22039688
2-(4-carbamimidoylanilino)-2-[3-ethyl-5-[(1-methylpiperidin-4-yl)amino]phenyl]acetate;hydrochloride (PubChem CID 22039688) has the molecular formula C23H31ClN5O2- and a molecular weight of 444.99 g/mol. Its IUPAC name is 2-(4-carbamimidoylanilino)-2-[3-ethyl-5-[(1-methylpiperidin-4-yl)amino]phenyl]acetate;hydrochloride.
| Compound Name | 2-(4-carbamimidoylanilino)-2-[3-ethyl-5-[(1-methylpiperidin-4-yl)amino]phenyl]acetate;hydrochloride |
|---|---|
| PubChem CID | 22039688 |
| Molecular Formula | C23H31ClN5O2- |
| Molecular Weight | 444.99 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | 2-(4-carbamimidoylanilino)-2-[3-ethyl-5-[(1-methylpiperidin-4-yl)amino]phenyl]acetate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(NC(C(=O)[O-])c2cc(CC)cc(NC3CCN(C)CC3)c2)cc1 |
| InChI | InChI=1S/C23H31N5O2.ClH/c1-3-15-12-17(14-20(13-15)26-19-8-10-28(2)11-9-19)21(23(29)30)27-18-6-4-16(5-7-18)22(24)25;/h4-7,12-14,19,21,26-27H,3,8-11H2,1-2H3,(H3,24,25)(H,29,30);1H/p-1 |
| InChIKey | QYLLKHOXKCEMRE-UHFFFAOYSA-M |
| XLogP | 2.36 |
| TPSA | 117.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.99 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|