C25H27ClN3O4- — CID 22039656
2-(4-carbamimidoylanilino)-2-[5-ethyl-2-(2-hydroxyethoxy)-3-phenylphenyl]acetate;hydrochloride (PubChem CID 22039656) has the molecular formula C25H27ClN3O4- and a molecular weight of 468.96 g/mol. Its IUPAC name is 2-(4-carbamimidoylanilino)-2-[5-ethyl-2-(2-hydroxyethoxy)-3-phenylphenyl]acetate;hydrochloride.
| Compound Name | 2-(4-carbamimidoylanilino)-2-[5-ethyl-2-(2-hydroxyethoxy)-3-phenylphenyl]acetate;hydrochloride |
|---|---|
| PubChem CID | 22039656 |
| Molecular Formula | C25H27ClN3O4- |
| Molecular Weight | 468.96 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | 2-(4-carbamimidoylanilino)-2-[5-ethyl-2-(2-hydroxyethoxy)-3-phenylphenyl]acetate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(NC(C(=O)[O-])c2cc(CC)cc(-c3ccccc3)c2OCCO)cc1 |
| InChI | InChI=1S/C25H27N3O4.ClH/c1-2-16-14-20(17-6-4-3-5-7-17)23(32-13-12-29)21(15-16)22(25(30)31)28-19-10-8-18(9-11-19)24(26)27;/h3-11,14-15,22,28-29H,2,12-13H2,1H3,(H3,26,27)(H,30,31);1H/p-1 |
| InChIKey | OXTPWVHMWRGWOP-UHFFFAOYSA-M |
| XLogP | 2.90 |
| TPSA | 131.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.96 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|