C21H26N3O4- — CID 22039590
2-(4-carbamimidoylanilino)-2-[2-(2-hydroxyethoxy)-3-methyl-5-propylphenyl]acetate (PubChem CID 22039590) has the molecular formula C21H26N3O4- and a molecular weight of 384.46 g/mol. Its IUPAC name is 2-(4-carbamimidoylanilino)-2-[2-(2-hydroxyethoxy)-3-methyl-5-propylphenyl]acetate.
| Compound Name | 2-(4-carbamimidoylanilino)-2-[2-(2-hydroxyethoxy)-3-methyl-5-propylphenyl]acetate |
|---|---|
| PubChem CID | 22039590 |
| Molecular Formula | C21H26N3O4- |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | 2-(4-carbamimidoylanilino)-2-[2-(2-hydroxyethoxy)-3-methyl-5-propylphenyl]acetate |
| SMILES | [H]/N=C(\N)c1ccc(NC(C(=O)[O-])c2cc(CCC)cc(C)c2OCCO)cc1 |
| InChI | InChI=1S/C21H27N3O4/c1-3-4-14-11-13(2)19(28-10-9-25)17(12-14)18(21(26)27)24-16-7-5-15(6-8-16)20(22)23/h5-8,11-12,18,24-25H,3-4,9-10H2,1-2H3,(H3,22,23)(H,26,27)/p-1 |
| InChIKey | QEEUCZIVZBHYCF-UHFFFAOYSA-M |
| XLogP | 1.51 |
| TPSA | 131.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|